C26H42O4 — CID 59545021
[2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxymethoxymethanol (PubChem CID 59545021) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is [2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxymethoxymethanol.
| Compound Name | [2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxymethoxymethanol |
|---|---|
| PubChem CID | 59545021 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | [2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxymethoxymethanol |
| SMILES | Cc1c(C)c2c(c(C)c1OCOCO)CCC(C)(/C=C/CC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C26H42O4/c1-18(2)10-8-11-19(3)12-9-14-26(7)15-13-23-22(6)24(29-17-28-16-27)20(4)21(5)25(23)30-26/h9,14,18-19,27H,8,10-13,15-17H2,1-7H3/b14-9+ |
| InChIKey | AFQUDBVGAQWRRZ-NTEUORMPSA-N |
| XLogP | 6.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|