C28H46O4 — CID 59545061
7-[[2-(4,8-dimethylnonyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]heptanoic acid (PubChem CID 59545061) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is 7-[[2-(4,8-dimethylnonyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]heptanoic acid.
| Compound Name | 7-[[2-(4,8-dimethylnonyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]heptanoic acid |
|---|---|
| PubChem CID | 59545061 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 7-[[2-(4,8-dimethylnonyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]heptanoic acid |
| SMILES | CC(C)CCCC(C)CCCC1(C)CCc2cc(OCCCCCCC(=O)O)ccc2O1 |
| InChI | InChI=1S/C28H46O4/c1-22(2)11-9-12-23(3)13-10-18-28(4)19-17-24-21-25(15-16-26(24)32-28)31-20-8-6-5-7-14-27(29)30/h15-16,21-23H,5-14,17-20H2,1-4H3,(H,29,30) |
| InChIKey | RKILBLAORCIZHL-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|