About (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine
(3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine (PubChem CID 59545269) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine |
| PubChem CID | 59545269 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine |
| SMILES | CCc1ccc(N2C[C@H](C)C[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C15H23N/c1-4-14-5-7-15(8-6-14)16-10-12(2)9-13(3)11-16/h5-8,12-13H,4,9-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | BKAGCBRTVANQEW-CHWSQXEVSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine?
The IUPAC name of (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine (CID 59545269) is (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine.
What is the SMILES notation for (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine?
The canonical SMILES for (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine is CCc1ccc(N2C[C@H](C)C[C@@H](C)C2)cc1.
What is the InChIKey of (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine?
The InChIKey is BKAGCBRTVANQEW-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H23N/c1-4-14-5-7-15(8-6-14)16-10-12(2)9-13(3)11-16/h5-8,12-13H,4,9-11H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine?
(3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine has a molecular weight of 217.36 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-1-(4-ethylphenyl)-3,5-dimethylpiperidine is sourced from PubChem (CID 59545269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).