C14H19F2NO — CID 59545402
(2S,6R)-4-(4-ethyl-2,6-difluorophenyl)-2,6-dimethylmorpholine (PubChem CID 59545402) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is (2S,6R)-4-(4-ethyl-2,6-difluorophenyl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(4-ethyl-2,6-difluorophenyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 59545402 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (2S,6R)-4-(4-ethyl-2,6-difluorophenyl)-2,6-dimethylmorpholine |
| SMILES | CCc1cc(F)c(N2C[C@@H](C)O[C@@H](C)C2)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO/c1-4-11-5-12(15)14(13(16)6-11)17-7-9(2)18-10(3)8-17/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+ |
| InChIKey | OUFONVREBHEWAT-AOOOYVTPSA-N |
| XLogP | 3.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |