C21H27NO — CID 59545831
(2R,6S)-2,6-dimethyl-4-[3-[2-(4-methylphenyl)ethyl]phenyl]morpholine (PubChem CID 59545831) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-[3-[2-(4-methylphenyl)ethyl]phenyl]morpholine.
| Compound Name | (2R,6S)-2,6-dimethyl-4-[3-[2-(4-methylphenyl)ethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 59545831 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-[3-[2-(4-methylphenyl)ethyl]phenyl]morpholine |
| SMILES | Cc1ccc(CCc2cccc(N3C[C@@H](C)O[C@@H](C)C3)c2)cc1 |
| InChI | InChI=1S/C21H27NO/c1-16-7-9-19(10-8-16)11-12-20-5-4-6-21(13-20)22-14-17(2)23-18(3)15-22/h4-10,13,17-18H,11-12,14-15H2,1-3H3/t17-,18+ |
| InChIKey | UIQCZVNVUVWTQB-HDICACEKSA-N |
| XLogP | 4.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |