About potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate
potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate (PubChem CID 59546422) has the molecular formula C25H25KNO2P
and a molecular weight of 441.55 g/mol. Its IUPAC name is potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate |
| PubChem CID | 59546422 |
| Molecular Formula | C25H25KNO2P |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](/N=C/c1ccccc1P(c1ccccc1)c1ccccc1)C(=O)[O-].[K+] |
| InChI | InChI=1S/C25H26NO2P.K/c1-25(2,3)23(24(27)28)26-18-19-12-10-11-17-22(19)29(20-13-6-4-7-14-20)21-15-8-5-9-16-21;/h4-18,23H,1-3H3,(H,27,28);/q;+1/p-1/b26-18+;/t23-;/m1./s1 |
| InChIKey | NGWBXGUXXXQLBO-CCNYVGMNSA-M |
| XLogP | 0.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate?
The IUPAC name of potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate (CID 59546422) is potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate.
What is the SMILES notation for potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate?
The canonical SMILES for potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate is CC(C)(C)[C@H](/N=C/c1ccccc1P(c1ccccc1)c1ccccc1)C(=O)[O-].[K+].
What is the InChIKey of potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate?
The InChIKey is NGWBXGUXXXQLBO-CCNYVGMNSA-M. The full InChI is InChI=1S/C25H26NO2P.K/c1-25(2,3)23(24(27)28)26-18-19-12-10-11-17-22(19)29(20-13-6-4-7-14-20)21-15-8-5-9-16-21;/h4-18,23H,1-3H3,(H,27,28);/q;+1/p-1/b26-18+;/t23-;/m1./s1.
What are the key properties of potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate?
potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate has a molecular weight of 441.55 g/mol, XLogP of 0.03, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate is sourced from PubChem (CID 59546422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).