About iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine)
iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) (PubChem CID 59546880) has the molecular formula C40H30IrN3
and a molecular weight of 744.92 g/mol. Its IUPAC name is iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine).
Molecular Properties
| Compound Name | iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) |
| PubChem CID | 59546880 |
| Molecular Formula | C40H30IrN3 |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 745.21 |
| IUPAC Name | iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1-c1ccccc1.[Ir+3].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C18H14N.2C11H8N.Ir/c1-14-12-18(16-10-6-3-7-11-16)19-13-17(14)15-8-4-2-5-9-15;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-10,12-13H,1H3;2*1-6,8-9H;/q3*-1;+3 |
| InChIKey | ZMDNYRRUAZTHEE-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine)?
The IUPAC name of iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) (CID 59546880) is iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine).
What is the SMILES notation for iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine)?
The canonical SMILES for iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) is Cc1cc(-c2[c-]cccc2)ncc1-c1ccccc1.[Ir+3].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine)?
The InChIKey is ZMDNYRRUAZTHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N.2C11H8N.Ir/c1-14-12-18(16-10-6-3-7-11-16)19-13-17(14)15-8-4-2-5-9-15;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-10,12-13H,1H3;2*1-6,8-9H;/q3*-1;+3.
What are the key properties of iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine)?
iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) has a molecular weight of 744.92 g/mol, XLogP of 9.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium(3+);4-methyl-5-phenyl-2-phenylpyridine;bis(2-phenylpyridine) is sourced from PubChem (CID 59546880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).