C15H27NO — CID 59547384
1,3,4,4,5,5-hexamethyl-3-(2-methylbut-3-en-2-yl)pyrrolidin-2-one (PubChem CID 59547384) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1,3,4,4,5,5-hexamethyl-3-(2-methylbut-3-en-2-yl)pyrrolidin-2-one.
| Compound Name | 1,3,4,4,5,5-hexamethyl-3-(2-methylbut-3-en-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 59547384 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1,3,4,4,5,5-hexamethyl-3-(2-methylbut-3-en-2-yl)pyrrolidin-2-one |
| SMILES | C=CC(C)(C)C1(C)C(=O)N(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H27NO/c1-10-12(2,3)15(8)11(17)16(9)14(6,7)13(15,4)5/h10H,1H2,2-9H3 |
| InChIKey | PPQRRUPNISBNRY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|