About N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine
N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine (PubChem CID 59547394) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine |
| PubChem CID | 59547394 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine |
| SMILES | C=C(C)C(=C)NCCCN |
| InChI | InChI=1S/C8H16N2/c1-7(2)8(3)10-6-4-5-9/h10H,1,3-6,9H2,2H3 |
| InChIKey | HEUCQKBTUBDIMF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine?
The IUPAC name of N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine (CID 59547394) is N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine.
What is the SMILES notation for N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine?
The canonical SMILES for N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine is C=C(C)C(=C)NCCCN.
What is the InChIKey of N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine?
The InChIKey is HEUCQKBTUBDIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-7(2)8(3)10-6-4-5-9/h10H,1,3-6,9H2,2H3.
What are the key properties of N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine?
N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine has a molecular weight of 140.23 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-methylbuta-1,3-dien-2-yl)propane-1,3-diamine is sourced from PubChem (CID 59547394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).