C14H28N2O — CID 59547464
1,1-dimethyl-3-[[(5R)-1,3,3,5-tetramethylcyclohexyl]methyl]urea (PubChem CID 59547464) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[(5R)-1,3,3,5-tetramethylcyclohexyl]methyl]urea.
| Compound Name | 1,1-dimethyl-3-[[(5R)-1,3,3,5-tetramethylcyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 59547464 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 1,1-dimethyl-3-[[(5R)-1,3,3,5-tetramethylcyclohexyl]methyl]urea |
| SMILES | C[C@@H]1CC(C)(C)CC(C)(CNC(=O)N(C)C)C1 |
| InChI | InChI=1S/C14H28N2O/c1-11-7-13(2,3)9-14(4,8-11)10-15-12(17)16(5)6/h11H,7-10H2,1-6H3,(H,15,17)/t11-,14?/m1/s1 |
| InChIKey | XTOSMVGISQWJFW-YNODCEANSA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |