C30H33N5O5 — CID 59547690
2-[benzyl-[(4-nitrophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 59547690) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 2-[benzyl-[(4-nitrophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | 2-[benzyl-[(4-nitrophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59547690 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 2-[benzyl-[(4-nitrophenyl)methyl]amino]propyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | CC(COC(=O)N1CCC(n2c(=O)[nH]c3ccccc32)CC1)N(Cc1ccccc1)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H33N5O5/c1-22(33(19-23-7-3-2-4-8-23)20-24-11-13-26(14-12-24)35(38)39)21-40-30(37)32-17-15-25(16-18-32)34-28-10-6-5-9-27(28)31-29(34)36/h2-14,22,25H,15-21H2,1H3,(H,31,36) |
| InChIKey | MCXSSRJQWMLAPY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 113.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|