C25H29Cl2F3N2O5S — CID 59547796
ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(3,3,3-trifluoropropylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 59547796) has the molecular formula C25H29Cl2F3N2O5S and a molecular weight of 597.48 g/mol. Its IUPAC name is ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(3,3,3-trifluoropropylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(3,3,3-trifluoropropylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 59547796 |
| Molecular Formula | C25H29Cl2F3N2O5S |
| Molecular Weight | 597.48 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(3,3,3-trifluoropropylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | CCOC(=O)NC1CCc2ccc(OCCNS(=O)(=O)CCC(F)(F)F)cc2C1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H29Cl2F3N2O5S/c1-2-36-24(33)32-23-8-5-17-4-6-18(37-11-10-31-38(34,35)12-9-25(28,29)30)15-19(17)20(23)13-16-3-7-21(26)22(27)14-16/h3-4,6-7,14-15,20,23,31H,2,5,8-13H2,1H3,(H,32,33) |
| InChIKey | WDVKQXPWTMAJFX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|