About 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid
4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid (PubChem CID 59547946) has the molecular formula C19H12F5N3O3
and a molecular weight of 425.31 g/mol. Its IUPAC name is 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid |
| PubChem CID | 59547946 |
| Molecular Formula | C19H12F5N3O3 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2ccc(NC(=O)c3c(F)cccc3F)n2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F5N3O3/c20-13-2-1-3-14(21)16(13)17(28)25-15-6-7-27(26-15)9-11-5-4-10(18(29)30)8-12(11)19(22,23)24/h1-8H,9H2,(H,29,30)(H,25,26,28) |
| InChIKey | HHOGMXNSPMQGAA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid?
The IUPAC name of 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid (CID 59547946) is 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid?
The canonical SMILES for 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid is O=C(O)c1ccc(Cn2ccc(NC(=O)c3c(F)cccc3F)n2)c(C(F)(F)F)c1.
What is the InChIKey of 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid?
The InChIKey is HHOGMXNSPMQGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F5N3O3/c20-13-2-1-3-14(21)16(13)17(28)25-15-6-7-27(26-15)9-11-5-4-10(18(29)30)8-12(11)19(22,23)24/h1-8H,9H2,(H,29,30)(H,25,26,28).
What are the key properties of 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid?
4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid has a molecular weight of 425.31 g/mol, XLogP of 4.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[(2,6-difluorobenzoyl)amino]pyrazol-1-yl]methyl]-3-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 59547946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).