C28H26N6O2 — CID 59548042
(11S)-5-anilino-11-(hydroxymethyl)-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 59548042) has the molecular formula C28H26N6O2 and a molecular weight of 478.56 g/mol. Its IUPAC name is (11S)-5-anilino-11-(hydroxymethyl)-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | (11S)-5-anilino-11-(hydroxymethyl)-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 59548042 |
| Molecular Formula | C28H26N6O2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (11S)-5-anilino-11-(hydroxymethyl)-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccccc4)cc3)c2Nc2ccccc2)N2C[C@@H](CO)N=C12 |
| InChI | InChI=1S/C28H26N6O2/c1-32-27(36)24-25(29-22-10-6-3-7-11-22)34(31-26(24)33-17-23(18-35)30-28(32)33)16-19-12-14-21(15-13-19)20-8-4-2-5-9-20/h2-15,23,29,35H,16-18H2,1H3/t23-/m0/s1 |
| InChIKey | BIFVFYNVUIMYOI-QHCPKHFHSA-N |
| XLogP | 3.96 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |