C27H25F3N6O2 — CID 59548043
(11R,15S)-5-anilino-4-[[4-(2,2-difluoropropanoyl)-3-fluorophenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 59548043) has the molecular formula C27H25F3N6O2 and a molecular weight of 522.53 g/mol. Its IUPAC name is (11R,15S)-5-anilino-4-[[4-(2,2-difluoropropanoyl)-3-fluorophenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-4-[[4-(2,2-difluoropropanoyl)-3-fluorophenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 59548043 |
| Molecular Formula | C27H25F3N6O2 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (11R,15S)-5-anilino-4-[[4-(2,2-difluoropropanoyl)-3-fluorophenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(C(=O)C(C)(F)F)c(F)c3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C27H25F3N6O2/c1-27(29,30)22(37)17-12-11-15(13-18(17)28)14-35-23(31-16-7-4-3-5-8-16)21-24(33-35)36-20-10-6-9-19(20)32-26(36)34(2)25(21)38/h3-5,7-8,11-13,19-20,31H,6,9-10,14H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | ZPAWMKAGGPYAQJ-UXHICEINSA-N |
| XLogP | 4.83 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |