About CID 59548152
CID 59548152 (PubChem CID 59548152) has the molecular formula C24H30F2O3
and a molecular weight of 404.50 g/mol.
Molecular Properties
| Compound Name | CID 59548152 |
| PubChem CID | 59548152 |
| Molecular Formula | C24H30F2O3 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | — |
| SMILES | C[C@]12CC=C3C4=C(CCC3C1CC[C@]21OCCC1=C(F)F)CC1(CC4)OCCO1 |
| InChI | InChI=1S/C24H30F2O3/c1-22-8-4-17-16-5-9-23(27-12-13-28-23)14-15(16)2-3-18(17)19(22)6-10-24(22)20(21(25)26)7-11-29-24/h4,18-19H,2-3,5-14H2,1H3/t18?,19?,22-,24+/m0/s1 |
| InChIKey | SSYQQJXKVBLEMA-IDMMRLHFSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59548152 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59548152?
The IUPAC name of CID 59548152 (CID 59548152) is not available.
What is the SMILES notation for CID 59548152?
The canonical SMILES for CID 59548152 is C[C@]12CC=C3C4=C(CCC3C1CC[C@]21OCCC1=C(F)F)CC1(CC4)OCCO1.
What is the InChIKey of CID 59548152?
The InChIKey is SSYQQJXKVBLEMA-IDMMRLHFSA-N. The full InChI is InChI=1S/C24H30F2O3/c1-22-8-4-17-16-5-9-23(27-12-13-28-23)14-15(16)2-3-18(17)19(22)6-10-24(22)20(21(25)26)7-11-29-24/h4,18-19H,2-3,5-14H2,1H3/t18?,19?,22-,24+/m0/s1.
What are the key properties of CID 59548152?
CID 59548152 has a molecular weight of 404.50 g/mol, XLogP of 5.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59548152 is sourced from PubChem (CID 59548152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).