C30H28ClN7O2 — CID 59548227
4-[2-[(6-chloro-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine (PubChem CID 59548227) has the molecular formula C30H28ClN7O2 and a molecular weight of 554.05 g/mol. Its IUPAC name is 4-[2-[(6-chloro-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-[(6-chloro-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 59548227 |
| Molecular Formula | C30H28ClN7O2 |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 4-[2-[(6-chloro-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc(C)nc(-c3cccnc3Nc3ccc(Cl)nc3)n2)cc1 |
| InChI | InChI=1S/C30H28ClN7O2/c1-20-34-29(26-5-4-16-32-28(26)36-23-10-15-27(31)33-17-23)37-30(35-20)38(18-21-6-11-24(39-2)12-7-21)19-22-8-13-25(40-3)14-9-22/h4-17H,18-19H2,1-3H3,(H,32,36) |
| InChIKey | RSJHLEOOMWIAAY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|