C14H13ClN8 — CID 59548308
5-N-[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]-2-chloropyridine-3,5-diamine (PubChem CID 59548308) has the molecular formula C14H13ClN8 and a molecular weight of 328.77 g/mol. Its IUPAC name is 5-N-[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]-2-chloropyridine-3,5-diamine.
| Compound Name | 5-N-[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]-2-chloropyridine-3,5-diamine |
|---|---|
| PubChem CID | 59548308 |
| Molecular Formula | C14H13ClN8 |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-N-[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]-2-chloropyridine-3,5-diamine |
| SMILES | Cc1nc(N)nc(-c2cccnc2Nc2cnc(Cl)c(N)c2)n1 |
| InChI | InChI=1S/C14H13ClN8/c1-7-20-13(23-14(17)21-7)9-3-2-4-18-12(9)22-8-5-10(16)11(15)19-6-8/h2-6H,16H2,1H3,(H,18,22)(H2,17,20,21,23) |
| InChIKey | OZAVYIVPURAMCC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|