C18H20ClN9O3S — CID 59548444
N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]morpholine-4-sulfonamide (PubChem CID 59548444) has the molecular formula C18H20ClN9O3S and a molecular weight of 477.94 g/mol. Its IUPAC name is N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]morpholine-4-sulfonamide.
| Compound Name | N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 59548444 |
| Molecular Formula | C18H20ClN9O3S |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]morpholine-4-sulfonamide |
| SMILES | Cc1nc(N)nc(-c2cccnc2Nc2cnc(Cl)c(NS(=O)(=O)N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C18H20ClN9O3S/c1-11-23-17(26-18(20)24-11)13-3-2-4-21-16(13)25-12-9-14(15(19)22-10-12)27-32(29,30)28-5-7-31-8-6-28/h2-4,9-10,27H,5-8H2,1H3,(H,21,25)(H2,20,23,24,26) |
| InChIKey | AZUIZZBFQBKTCG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|