C29H36N4O5S — CID 59549009
17-cyclohexyl-18-(4-methoxyphenyl)-9-methyl-10,10-dioxo-10λ6-thia-1,4,9,11-tetrazatricyclo[11.5.2.016,19]icosa-13(20),14,16(19),17-tetraene-3,12-dione (PubChem CID 59549009) has the molecular formula C29H36N4O5S and a molecular weight of 552.70 g/mol. Its IUPAC name is 17-cyclohexyl-18-(4-methoxyphenyl)-9-methyl-10,10-dioxo-10λ6-thia-1,4,9,11-tetrazatricyclo[11.5.2.016,19]icosa-13(20),14,16(19),17-tetraene-3,12-dione.
| Compound Name | 17-cyclohexyl-18-(4-methoxyphenyl)-9-methyl-10,10-dioxo-10λ6-thia-1,4,9,11-tetrazatricyclo[11.5.2.016,19]icosa-13(20),14,16(19),17-tetraene-3,12-dione |
|---|---|
| PubChem CID | 59549009 |
| Molecular Formula | C29H36N4O5S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 17-cyclohexyl-18-(4-methoxyphenyl)-9-methyl-10,10-dioxo-10λ6-thia-1,4,9,11-tetrazatricyclo[11.5.2.016,19]icosa-13(20),14,16(19),17-tetraene-3,12-dione |
| SMILES | COc1ccc(-c2c(C3CCCCC3)c3ccc4cc3n2CC(=O)NCCCCN(C)S(=O)(=O)NC4=O)cc1 |
| InChI | InChI=1S/C29H36N4O5S/c1-32-17-7-6-16-30-26(34)19-33-25-18-22(29(35)31-39(32,36)37)12-15-24(25)27(20-8-4-3-5-9-20)28(33)21-10-13-23(38-2)14-11-21/h10-15,18,20H,3-9,16-17,19H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | YOLCBIVXUSHZAD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |