C27H29NO5 — CID 59549323
(Z)-6-[(2S,4S,5R)-2-(2,6-dimethylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 59549323) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-2-(2,6-dimethylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-2-(2,6-dimethylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 59549323 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-2-(2,6-dimethylquinolin-3-yl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | Cc1ccc2nc(C)c([C@H]3OC[C@@H](C/C=C\CCC(=O)O)[C@@H](c4ccccc4O)O3)cc2c1 |
| InChI | InChI=1S/C27H29NO5/c1-17-12-13-23-20(14-17)15-22(18(2)28-23)27-32-16-19(8-4-3-5-11-25(30)31)26(33-27)21-9-6-7-10-24(21)29/h3-4,6-7,9-10,12-15,19,26-27,29H,5,8,11,16H2,1-2H3,(H,30,31)/b4-3-/t19-,26+,27+/m1/s1 |
| InChIKey | IWILQWNLIKYGJK-UOVUSXGASA-N |
| XLogP | 5.77 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|