About N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine
N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine (PubChem CID 59549676) has the molecular formula C12H18N6
and a molecular weight of 246.32 g/mol. Its IUPAC name is N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine |
| PubChem CID | 59549676 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine |
| SMILES | NCCCCCNc1ccc(-n2ncnn2)cc1 |
| InChI | InChI=1S/C12H18N6/c13-8-2-1-3-9-14-11-4-6-12(7-5-11)18-16-10-15-17-18/h4-7,10,14H,1-3,8-9,13H2 |
| InChIKey | BOQAPYTUYAYTQU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine?
The IUPAC name of N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine (CID 59549676) is N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine.
What is the SMILES notation for N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine?
The canonical SMILES for N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine is NCCCCCNc1ccc(-n2ncnn2)cc1.
What is the InChIKey of N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine?
The InChIKey is BOQAPYTUYAYTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N6/c13-8-2-1-3-9-14-11-4-6-12(7-5-11)18-16-10-15-17-18/h4-7,10,14H,1-3,8-9,13H2.
What are the key properties of N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine?
N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine has a molecular weight of 246.32 g/mol, XLogP of 1.20, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(tetrazol-2-yl)phenyl]pentane-1,5-diamine is sourced from PubChem (CID 59549676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).