C9H6O6 — CID 59550062
(1S,2S,6S,8S)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone (PubChem CID 59550062) has the molecular formula C9H6O6 and a molecular weight of 210.14 g/mol. Its IUPAC name is (1S,2S,6S,8S)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone.
| Compound Name | (1S,2S,6S,8S)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 59550062 |
| Molecular Formula | C9H6O6 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | (1S,2S,6S,8S)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
| SMILES | O=C1OC(=O)[C@H]2C[C@@H]3C(=O)OC(=O)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C9H6O6/c10-6-2-1-3-5(4(2)8(12)14-6)9(13)15-7(3)11/h2-5H,1H2/t2-,3-,4-,5-/m0/s1 |
| InChIKey | NLWBEORDOPDUPM-FCAWWPLPSA-N |
| XLogP | -0.98 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|