C23H22N2O — CID 59550191
(2E,5E)-2,5-bis(2,3-dihydroindol-1-ylmethylidene)cyclopentan-1-one (PubChem CID 59550191) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is (2E,5E)-2,5-bis(2,3-dihydroindol-1-ylmethylidene)cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis(2,3-dihydroindol-1-ylmethylidene)cyclopentan-1-one |
|---|---|
| PubChem CID | 59550191 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2E,5E)-2,5-bis(2,3-dihydroindol-1-ylmethylidene)cyclopentan-1-one |
| SMILES | O=C1/C(=C/N2CCc3ccccc32)CC/C1=C\N1CCc2ccccc21 |
| InChI | InChI=1S/C23H22N2O/c26-23-19(15-24-13-11-17-5-1-3-7-21(17)24)9-10-20(23)16-25-14-12-18-6-2-4-8-22(18)25/h1-8,15-16H,9-14H2/b19-15+,20-16+ |
| InChIKey | AIBMXMVHTFUJCH-MXWIWYRXSA-N |
| XLogP | 4.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|