C13H15NO3PV- — CID 59550589
ethyl 5-oxo-1-phosphanyl-2,3,4,7-tetrahydro-1-benzazepin-7-ide-4-carboxylate;vanadium (PubChem CID 59550589) has the molecular formula C13H15NO3PV- and a molecular weight of 315.19 g/mol. Its IUPAC name is ethyl 5-oxo-1-phosphanyl-2,3,4,7-tetrahydro-1-benzazepin-7-ide-4-carboxylate;vanadium.
| Compound Name | ethyl 5-oxo-1-phosphanyl-2,3,4,7-tetrahydro-1-benzazepin-7-ide-4-carboxylate;vanadium |
|---|---|
| PubChem CID | 59550589 |
| Molecular Formula | C13H15NO3PV- |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | ethyl 5-oxo-1-phosphanyl-2,3,4,7-tetrahydro-1-benzazepin-7-ide-4-carboxylate;vanadium |
| SMILES | CCOC(=O)C1CCN(P)c2cc[c-]cc2C1=O.[V] |
| InChI | InChI=1S/C13H15NO3P.V/c1-2-17-13(16)10-7-8-14(18)11-6-4-3-5-9(11)12(10)15;/h4-6,10H,2,7-8,18H2,1H3;/q-1; |
| InChIKey | GNZHIWDEQAEURI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|