C38H48N8O2 — CID 59550750
tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(4-pyridin-4-ylphenyl)methylamino]propanoate (PubChem CID 59550750) has the molecular formula C38H48N8O2 and a molecular weight of 648.86 g/mol. Its IUPAC name is tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(4-pyridin-4-ylphenyl)methylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(4-pyridin-4-ylphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 59550750 |
| Molecular Formula | C38H48N8O2 |
| Molecular Weight | 648.86 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(4-pyridin-4-ylphenyl)methylamino]propanoate |
| SMILES | CCc1c(NC[C@H](NCc2ccc(-c3ccncc3)cc2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C38H48N8O2/c1-5-31-35(43-25-44-36(31)46-21-16-29(17-22-46)32-13-12-30-7-6-18-40-34(30)45-32)42-24-33(37(47)48-38(2,3)4)41-23-26-8-10-27(11-9-26)28-14-19-39-20-15-28/h8-15,19-20,25,29,33,41H,5-7,16-18,21-24H2,1-4H3,(H,40,45)(H,42,43,44)/t33-/m0/s1 |
| InChIKey | IITITWYLHSWNNF-XIFFEERXSA-N |
| XLogP | 6.15 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.86 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |