C36H50N8O3 — CID 59550768
3-pyridin-4-ylpropyl N-[(2S)-1-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-5,5-dimethyl-3-oxohexan-2-yl]carbamate (PubChem CID 59550768) has the molecular formula C36H50N8O3 and a molecular weight of 642.85 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl N-[(2S)-1-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-5,5-dimethyl-3-oxohexan-2-yl]carbamate.
| Compound Name | 3-pyridin-4-ylpropyl N-[(2S)-1-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-5,5-dimethyl-3-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59550768 |
| Molecular Formula | C36H50N8O3 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.40 |
| IUPAC Name | 3-pyridin-4-ylpropyl N-[(2S)-1-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-5,5-dimethyl-3-oxohexan-2-yl]carbamate |
| SMILES | Cc1nc(NC[C@H](NC(=O)OCCCc2ccncc2)C(=O)CC(C)(C)C)c(C)c(N2CCC(c3ccc4c(n3)NCCC4)CC2)n1 |
| InChI | InChI=1S/C36H50N8O3/c1-24-32(39-23-30(31(45)22-36(3,4)5)43-35(46)47-21-7-8-26-12-17-37-18-13-26)40-25(2)41-34(24)44-19-14-27(15-20-44)29-11-10-28-9-6-16-38-33(28)42-29/h10-13,17-18,27,30H,6-9,14-16,19-23H2,1-5H3,(H,38,42)(H,43,46)(H,39,40,41)/t30-/m0/s1 |
| InChIKey | BTDAKDZFZWCKAD-PMERELPUSA-N |
| XLogP | 5.77 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|