C35H48N8O4 — CID 59550769
tert-butyl (2S)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-pyridin-4-ylpropoxycarbonylamino)propanoate (PubChem CID 59550769) has the molecular formula C35H48N8O4 and a molecular weight of 644.82 g/mol. Its IUPAC name is tert-butyl (2S)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-pyridin-4-ylpropoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-pyridin-4-ylpropoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 59550769 |
| Molecular Formula | C35H48N8O4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.38 |
| IUPAC Name | tert-butyl (2S)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-pyridin-4-ylpropoxycarbonylamino)propanoate |
| SMILES | Cc1nc(NC[C@H](NC(=O)OCCCc2ccncc2)C(=O)OC(C)(C)C)c(C)c(N2CCC(c3ccc4c(n3)NCCC4)CC2)n1 |
| InChI | InChI=1S/C35H48N8O4/c1-23-30(38-22-29(33(44)47-35(3,4)5)42-34(45)46-21-7-8-25-12-17-36-18-13-25)39-24(2)40-32(23)43-19-14-26(15-20-43)28-11-10-27-9-6-16-37-31(27)41-28/h10-13,17-18,26,29H,6-9,14-16,19-22H2,1-5H3,(H,37,41)(H,42,45)(H,38,39,40)/t29-/m0/s1 |
| InChIKey | XMISXDZXNVAIJE-LJAQVGFWSA-N |
| XLogP | 5.11 |
| TPSA | 143.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|