C36H46N8O2 — CID 59550799
tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(quinolin-3-ylmethylamino)propanoate (PubChem CID 59550799) has the molecular formula C36H46N8O2 and a molecular weight of 622.82 g/mol. Its IUPAC name is tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(quinolin-3-ylmethylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(quinolin-3-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 59550799 |
| Molecular Formula | C36H46N8O2 |
| Molecular Weight | 622.82 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(quinolin-3-ylmethylamino)propanoate |
| SMILES | CCc1c(NC[C@H](NCc2cnc3ccccc3c2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C36H46N8O2/c1-5-28-33(40-22-31(35(45)46-36(2,3)4)39-21-24-19-27-9-6-7-11-29(27)38-20-24)41-23-42-34(28)44-17-14-25(15-18-44)30-13-12-26-10-8-16-37-32(26)43-30/h6-7,9,11-13,19-20,23,25,31,39H,5,8,10,14-18,21-22H2,1-4H3,(H,37,43)(H,40,41,42)/t31-/m0/s1 |
| InChIKey | XRPOLRRGQOTYMF-HKBQPEDESA-N |
| XLogP | 5.64 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.82 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |