C10H18N2O3S — CID 59551220
2-[(2S)-2-isocyanato-3,3-dimethylbutyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 59551220) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-[(2S)-2-isocyanato-3,3-dimethylbutyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[(2S)-2-isocyanato-3,3-dimethylbutyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 59551220 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-[(2S)-2-isocyanato-3,3-dimethylbutyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | CC(C)(C)[C@@H](CN1CCCS1(=O)=O)N=C=O |
| InChI | InChI=1S/C10H18N2O3S/c1-10(2,3)9(11-8-13)7-12-5-4-6-16(12,14)15/h9H,4-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | SYZCHQKLKKBINZ-SECBINFHSA-N |
| XLogP | 0.77 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|