About N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine
N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine (PubChem CID 59551553) has the molecular formula C8H16F3N
and a molecular weight of 183.22 g/mol. Its IUPAC name is N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine |
| PubChem CID | 59551553 |
| Molecular Formula | C8H16F3N |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C8H16F3N/c1-6(2,3)12-7(4,5)8(9,10)11/h12H,1-5H3 |
| InChIKey | DLVJGDSEIBOVJU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine?
The IUPAC name of N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine (CID 59551553) is N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine.
What is the SMILES notation for N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine?
The canonical SMILES for N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine is CC(C)(C)NC(C)(C)C(F)(F)F.
What is the InChIKey of N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine?
The InChIKey is DLVJGDSEIBOVJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3N/c1-6(2,3)12-7(4,5)8(9,10)11/h12H,1-5H3.
What are the key properties of N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine?
N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine has a molecular weight of 183.22 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1,1,1-trifluoro-2-methylpropan-2-amine is sourced from PubChem (CID 59551553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).