C20H24N6S — CID 59551932
N'-methyl-N-[(1-methylindol-2-yl)methyl]-N'-(3-pyrrol-1-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine (PubChem CID 59551932) has the molecular formula C20H24N6S and a molecular weight of 380.52 g/mol. Its IUPAC name is N'-methyl-N-[(1-methylindol-2-yl)methyl]-N'-(3-pyrrol-1-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine.
| Compound Name | N'-methyl-N-[(1-methylindol-2-yl)methyl]-N'-(3-pyrrol-1-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 59551932 |
| Molecular Formula | C20H24N6S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N'-methyl-N-[(1-methylindol-2-yl)methyl]-N'-(3-pyrrol-1-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
| SMILES | CN(CCCNCc1cc2ccccc2n1C)c1nc(-n2cccc2)ns1 |
| InChI | InChI=1S/C20H24N6S/c1-24(20-22-19(23-27-20)26-12-5-6-13-26)11-7-10-21-15-17-14-16-8-3-4-9-18(16)25(17)2/h3-6,8-9,12-14,21H,7,10-11,15H2,1-2H3 |
| InChIKey | UMZDHHHGRUGUPC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|