About 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one
1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one (PubChem CID 59552004) has the molecular formula C23H22N2O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one |
| PubChem CID | 59552004 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1[C@H](c1ccccc1)[C@@H](Oc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O2/c26-21-15-9-17-25(21)22(18-10-3-1-4-11-18)23(19-12-5-2-6-13-19)27-20-14-7-8-16-24-20/h1-8,10-14,16,22-23H,9,15,17H2/t22-,23+/m1/s1 |
| InChIKey | CRGBNWZXLLWUHC-PKTZIBPZSA-N |
| XLogP | 4.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one?
The IUPAC name of 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one (CID 59552004) is 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one?
The canonical SMILES for 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one is O=C1CCCN1[C@H](c1ccccc1)[C@@H](Oc1ccccn1)c1ccccc1.
What is the InChIKey of 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one?
The InChIKey is CRGBNWZXLLWUHC-PKTZIBPZSA-N. The full InChI is InChI=1S/C23H22N2O2/c26-21-15-9-17-25(21)22(18-10-3-1-4-11-18)23(19-12-5-2-6-13-19)27-20-14-7-8-16-24-20/h1-8,10-14,16,22-23H,9,15,17H2/t22-,23+/m1/s1.
What are the key properties of 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one?
1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one has a molecular weight of 358.44 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-1,2-diphenyl-2-pyridin-2-yloxyethyl]pyrrolidin-2-one is sourced from PubChem (CID 59552004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).