C11H18O2 — CID 59552182
(3S,4R,5R)-5-ethenyl-4,7,7-trimethyl-1,6-dioxaspiro[2.5]octane (PubChem CID 59552182) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3S,4R,5R)-5-ethenyl-4,7,7-trimethyl-1,6-dioxaspiro[2.5]octane.
| Compound Name | (3S,4R,5R)-5-ethenyl-4,7,7-trimethyl-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 59552182 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3S,4R,5R)-5-ethenyl-4,7,7-trimethyl-1,6-dioxaspiro[2.5]octane |
| SMILES | C=C[C@H]1OC(C)(C)C[C@@]2(CO2)[C@@H]1C |
| InChI | InChI=1S/C11H18O2/c1-5-9-8(2)11(7-12-11)6-10(3,4)13-9/h5,8-9H,1,6-7H2,2-4H3/t8-,9-,11-/m1/s1 |
| InChIKey | GZJBTXQQWBZUKL-FXPVBKGRSA-N |
| XLogP | 2.14 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|