About 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one
1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one (PubChem CID 59552193) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one.
Molecular Properties
| Compound Name | 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one |
| PubChem CID | 59552193 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one |
| SMILES | C=C[C@@H](C)[C@@H](C)[C@@]1(CC(C)=O)CO1 |
| InChI | InChI=1S/C11H18O2/c1-5-8(2)10(4)11(7-13-11)6-9(3)12/h5,8,10H,1,6-7H2,2-4H3/t8-,10-,11-/m1/s1 |
| InChIKey | SOYUGOYKODATIL-FBIMIBRVSA-N |
| XLogP | 2.19 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one?
The IUPAC name of 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one (CID 59552193) is 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one.
What is the SMILES notation for 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one?
The canonical SMILES for 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one is C=C[C@@H](C)[C@@H](C)[C@@]1(CC(C)=O)CO1.
What is the InChIKey of 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one?
The InChIKey is SOYUGOYKODATIL-FBIMIBRVSA-N. The full InChI is InChI=1S/C11H18O2/c1-5-8(2)10(4)11(7-13-11)6-9(3)12/h5,8,10H,1,6-7H2,2-4H3/t8-,10-,11-/m1/s1.
What are the key properties of 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one?
1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one has a molecular weight of 182.26 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2-[(2R,3R)-3-methylpent-4-en-2-yl]oxiran-2-yl]propan-2-one is sourced from PubChem (CID 59552193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).