C12H17F5O3 — CID 59552233
methoxymethyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate (PubChem CID 59552233) has the molecular formula C12H17F5O3 and a molecular weight of 304.26 g/mol. Its IUPAC name is methoxymethyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate.
| Compound Name | methoxymethyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 59552233 |
| Molecular Formula | C12H17F5O3 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methoxymethyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate |
| SMILES | CCC1CC(C(=O)OCOC)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C12H17F5O3/c1-4-7-5-8(9(18)20-6-19-3)12(16,17)11(7,15)10(2,13)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | XCGZEHUYBOYRRD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|