C15H21F5O6 — CID 59552235
bis(methoxymethyl) 5-ethyl-2,2,3,4,4-pentafluoro-3-methylcyclohexane-1,1-dicarboxylate (PubChem CID 59552235) has the molecular formula C15H21F5O6 and a molecular weight of 392.32 g/mol. Its IUPAC name is bis(methoxymethyl) 5-ethyl-2,2,3,4,4-pentafluoro-3-methylcyclohexane-1,1-dicarboxylate.
| Compound Name | bis(methoxymethyl) 5-ethyl-2,2,3,4,4-pentafluoro-3-methylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 59552235 |
| Molecular Formula | C15H21F5O6 |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | bis(methoxymethyl) 5-ethyl-2,2,3,4,4-pentafluoro-3-methylcyclohexane-1,1-dicarboxylate |
| SMILES | CCC1CC(C(=O)OCOC)(C(=O)OCOC)C(F)(F)C(C)(F)C1(F)F |
| InChI | InChI=1S/C15H21F5O6/c1-5-9-6-13(10(21)25-7-23-3,11(22)26-8-24-4)15(19,20)12(2,16)14(9,17)18/h9H,5-8H2,1-4H3 |
| InChIKey | BQDBUBHULZPXSO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|