C12H8F12N2O2 — CID 59552294
2-[2,3-diamino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 59552294) has the molecular formula C12H8F12N2O2 and a molecular weight of 440.18 g/mol. Its IUPAC name is 2-[2,3-diamino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2,3-diamino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 59552294 |
| Molecular Formula | C12H8F12N2O2 |
| Molecular Weight | 440.18 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-[2,3-diamino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc(C(O)(C(F)(F)F)C(F)(F)F)c1N |
| InChI | InChI=1S/C12H8F12N2O2/c13-9(14,15)7(27,10(16,17)18)3-1-2-4(6(26)5(3)25)8(28,11(19,20)21)12(22,23)24/h1-2,27-28H,25-26H2 |
| InChIKey | PZDIAEZMIFFNAJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|