C14H19FO5S — CID 59552633
[(4S,5R)-5-(fluoromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 59552633) has the molecular formula C14H19FO5S and a molecular weight of 318.37 g/mol. Its IUPAC name is [(4S,5R)-5-(fluoromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4S,5R)-5-(fluoromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59552633 |
| Molecular Formula | C14H19FO5S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [(4S,5R)-5-(fluoromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2OC(C)(C)O[C@H]2CF)cc1 |
| InChI | InChI=1S/C14H19FO5S/c1-10-4-6-11(7-5-10)21(16,17)18-9-13-12(8-15)19-14(2,3)20-13/h4-7,12-13H,8-9H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | CZZWVQRXQNFWLG-STQMWFEESA-N |
| XLogP | 2.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|