About 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde
3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde (PubChem CID 59553034) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde |
| PubChem CID | 59553034 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde |
| SMILES | Nc1c(C=O)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C11H9NO3/c12-9-8(5-13)10(14)6-3-1-2-4-7(6)11(9)15/h1-5,14-15H,12H2 |
| InChIKey | UUSGZVVOHIFUCY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde?
The IUPAC name of 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde (CID 59553034) is 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde.
What is the SMILES notation for 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde?
The canonical SMILES for 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde is Nc1c(C=O)c(O)c2ccccc2c1O.
What is the InChIKey of 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde?
The InChIKey is UUSGZVVOHIFUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c12-9-8(5-13)10(14)6-3-1-2-4-7(6)11(9)15/h1-5,14-15H,12H2.
What are the key properties of 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde?
3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde has a molecular weight of 203.20 g/mol, XLogP of 1.65, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,4-dihydroxynaphthalene-2-carbaldehyde is sourced from PubChem (CID 59553034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).