C30H32FN5O5 — CID 59553499
N-[4-[2-[2,2-dimethoxyethyl(methyl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-fluoro-5-morpholin-4-ylbenzamide (PubChem CID 59553499) has the molecular formula C30H32FN5O5 and a molecular weight of 561.61 g/mol. Its IUPAC name is N-[4-[2-[2,2-dimethoxyethyl(methyl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-fluoro-5-morpholin-4-ylbenzamide.
| Compound Name | N-[4-[2-[2,2-dimethoxyethyl(methyl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-fluoro-5-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 59553499 |
| Molecular Formula | C30H32FN5O5 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | N-[4-[2-[2,2-dimethoxyethyl(methyl)amino]pyrimidin-4-yl]oxynaphthalen-1-yl]-3-fluoro-5-morpholin-4-ylbenzamide |
| SMILES | COC(CN(C)c1nccc(Oc2ccc(NC(=O)c3cc(F)cc(N4CCOCC4)c3)c3ccccc23)n1)OC |
| InChI | InChI=1S/C30H32FN5O5/c1-35(19-28(38-2)39-3)30-32-11-10-27(34-30)41-26-9-8-25(23-6-4-5-7-24(23)26)33-29(37)20-16-21(31)18-22(17-20)36-12-14-40-15-13-36/h4-11,16-18,28H,12-15,19H2,1-3H3,(H,33,37) |
| InChIKey | PDZOLFVMSKDRSZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|