C23H22ClF3N4O — CID 59553764
(2R)-2-[[(1S)-1-(6-chloro-2-pyridinyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propyl]amino]-N-methyl-2-phenylacetamide (PubChem CID 59553764) has the molecular formula C23H22ClF3N4O and a molecular weight of 462.90 g/mol. Its IUPAC name is (2R)-2-[[(1S)-1-(6-chloro-2-pyridinyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propyl]amino]-N-methyl-2-phenylacetamide.
| Compound Name | (2R)-2-[[(1S)-1-(6-chloro-2-pyridinyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propyl]amino]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 59553764 |
| Molecular Formula | C23H22ClF3N4O |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (2R)-2-[[(1S)-1-(6-chloro-2-pyridinyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propyl]amino]-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)[C@H](N[C@@H](CCc1ccc(C(F)(F)F)nc1)c1cccc(Cl)n1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClF3N4O/c1-28-22(32)21(16-6-3-2-4-7-16)31-18(17-8-5-9-20(24)30-17)12-10-15-11-13-19(29-14-15)23(25,26)27/h2-9,11,13-14,18,21,31H,10,12H2,1H3,(H,28,32)/t18-,21+/m0/s1 |
| InChIKey | HIKGWPZECIAYTP-GHTZIAJQSA-N |
| XLogP | 4.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|