C10H5F7O2S2 — CID 59553986
2-[4-(2,2-difluoroethenyl)phenyl]sulfanyl-1,1,2,2-tetrafluoroethanesulfonyl fluoride (PubChem CID 59553986) has the molecular formula C10H5F7O2S2 and a molecular weight of 354.27 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethenyl)phenyl]sulfanyl-1,1,2,2-tetrafluoroethanesulfonyl fluoride.
| Compound Name | 2-[4-(2,2-difluoroethenyl)phenyl]sulfanyl-1,1,2,2-tetrafluoroethanesulfonyl fluoride |
|---|---|
| PubChem CID | 59553986 |
| Molecular Formula | C10H5F7O2S2 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 2-[4-(2,2-difluoroethenyl)phenyl]sulfanyl-1,1,2,2-tetrafluoroethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)Sc1ccc(C=C(F)F)cc1 |
| InChI | InChI=1S/C10H5F7O2S2/c11-8(12)5-6-1-3-7(4-2-6)20-9(13,14)10(15,16)21(17,18)19/h1-5H |
| InChIKey | QQCRHFLEXZWZKG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|