C15H9F4O4S- — CID 59554726
4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 59554726) has the molecular formula C15H9F4O4S- and a molecular weight of 361.29 g/mol. Its IUPAC name is 4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 59554726 |
| Molecular Formula | C15H9F4O4S- |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 4-[(4-ethenylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | C=Cc1ccc(COc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C15H10F4O4S/c1-2-8-3-5-9(6-4-8)7-23-14-10(16)12(18)15(24(20,21)22)13(19)11(14)17/h2-6H,1,7H2,(H,20,21,22)/p-1 |
| InChIKey | FJKSXBDJVCDHLB-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|