C15H12F4O4S — CID 59554743
4-[(4-ethylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 59554743) has the molecular formula C15H12F4O4S and a molecular weight of 364.32 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[(4-ethylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 59554743 |
| Molecular Formula | C15H12F4O4S |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 4-[(4-ethylphenyl)methoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCc1ccc(COc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H12F4O4S/c1-2-8-3-5-9(6-4-8)7-23-14-10(16)12(18)15(24(20,21)22)13(19)11(14)17/h3-6H,2,7H2,1H3,(H,20,21,22) |
| InChIKey | PAKIUZMCVPPPKU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|