C50H34F12O9S — CID 59554745
4-[2-[4-[3,5-bis[4-[2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 59554745) has the molecular formula C50H34F12O9S and a molecular weight of 1038.86 g/mol. Its IUPAC name is 4-[2-[4-[3,5-bis[4-[2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[2-[4-[3,5-bis[4-[2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 59554745 |
| Molecular Formula | C50H34F12O9S |
| Molecular Weight | 1038.86 g/mol |
| Exact Mass | 1038.17 |
| IUPAC Name | 4-[2-[4-[3,5-bis[4-[2-(2,3,5,6-tetrafluoro-4-methylphenoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | Cc1c(F)c(F)c(OCCOc2ccc(-c3cc(-c4ccc(OCCOc5c(F)c(F)c(C)c(F)c5F)cc4)cc(-c4ccc(OCCOc5c(F)c(F)c(S(=O)(=O)O)c(F)c5F)cc4)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C50H34F12O9S/c1-24-35(51)39(55)47(40(56)36(24)52)69-18-15-66-32-9-3-26(4-10-32)29-21-30(27-5-11-33(12-6-27)67-16-19-70-48-41(57)37(53)25(2)38(54)42(48)58)23-31(22-29)28-7-13-34(14-8-28)68-17-20-71-49-43(59)45(61)50(72(63,64)65)46(62)44(49)60/h3-14,21-23H,15-20H2,1-2H3,(H,63,64,65) |
| InChIKey | BYOUGEIUBDSKAZ-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.86 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|