About 3,3-ditert-butyl-1,4-dihydropyridin-2-one
3,3-ditert-butyl-1,4-dihydropyridin-2-one (PubChem CID 59555261) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 3,3-ditert-butyl-1,4-dihydropyridin-2-one.
Molecular Properties
| Compound Name | 3,3-ditert-butyl-1,4-dihydropyridin-2-one |
| PubChem CID | 59555261 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3,3-ditert-butyl-1,4-dihydropyridin-2-one |
| SMILES | CC(C)(C)C1(C(C)(C)C)CC=CNC1=O |
| InChI | InChI=1S/C13H23NO/c1-11(2,3)13(12(4,5)6)8-7-9-14-10(13)15/h7,9H,8H2,1-6H3,(H,14,15) |
| InChIKey | UDVNWCLVFKBYSC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-ditert-butyl-1,4-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-ditert-butyl-1,4-dihydropyridin-2-one?
The IUPAC name of 3,3-ditert-butyl-1,4-dihydropyridin-2-one (CID 59555261) is 3,3-ditert-butyl-1,4-dihydropyridin-2-one.
What is the SMILES notation for 3,3-ditert-butyl-1,4-dihydropyridin-2-one?
The canonical SMILES for 3,3-ditert-butyl-1,4-dihydropyridin-2-one is CC(C)(C)C1(C(C)(C)C)CC=CNC1=O.
What is the InChIKey of 3,3-ditert-butyl-1,4-dihydropyridin-2-one?
The InChIKey is UDVNWCLVFKBYSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-11(2,3)13(12(4,5)6)8-7-9-14-10(13)15/h7,9H,8H2,1-6H3,(H,14,15).
What are the key properties of 3,3-ditert-butyl-1,4-dihydropyridin-2-one?
3,3-ditert-butyl-1,4-dihydropyridin-2-one has a molecular weight of 209.33 g/mol, XLogP of 3.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-ditert-butyl-1,4-dihydropyridin-2-one is sourced from PubChem (CID 59555261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).