C28H32N4O3 — CID 59555725
4-[3-ethoxy-4-[2-(6-methoxy-1H-indol-3-yl)ethylamino]anilino]-5,6,7,8-tetrahydroquinolin-8-ol (PubChem CID 59555725) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 4-[3-ethoxy-4-[2-(6-methoxy-1H-indol-3-yl)ethylamino]anilino]-5,6,7,8-tetrahydroquinolin-8-ol.
| Compound Name | 4-[3-ethoxy-4-[2-(6-methoxy-1H-indol-3-yl)ethylamino]anilino]-5,6,7,8-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 59555725 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 4-[3-ethoxy-4-[2-(6-methoxy-1H-indol-3-yl)ethylamino]anilino]-5,6,7,8-tetrahydroquinolin-8-ol |
| SMILES | CCOc1cc(Nc2ccnc3c2CCCC3O)ccc1NCCc1c[nH]c2cc(OC)ccc12 |
| InChI | InChI=1S/C28H32N4O3/c1-3-35-27-15-19(32-23-12-14-30-28-22(23)5-4-6-26(28)33)7-10-24(27)29-13-11-18-17-31-25-16-20(34-2)8-9-21(18)25/h7-10,12,14-17,26,29,31,33H,3-6,11,13H2,1-2H3,(H,30,32) |
| InChIKey | UQZCXLZZFZIPMT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|