C27H29F3N4O3 — CID 59556168
N-[2-[[(4S)-4-hydroxy-1-(4-isocyano-4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 59556168) has the molecular formula C27H29F3N4O3 and a molecular weight of 514.55 g/mol. Its IUPAC name is N-[2-[[(4S)-4-hydroxy-1-(4-isocyano-4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(4S)-4-hydroxy-1-(4-isocyano-4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59556168 |
| Molecular Formula | C27H29F3N4O3 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-[2-[[(4S)-4-hydroxy-1-(4-isocyano-4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCC(N2CC(NC(=O)CNC(=O)c3cccc(C(F)(F)F)c3)[C@@H](O)C2)CC1 |
| InChI | InChI=1S/C27H29F3N4O3/c1-31-26(19-7-3-2-4-8-19)12-10-21(11-13-26)34-16-22(23(35)17-34)33-24(36)15-32-25(37)18-6-5-9-20(14-18)27(28,29)30/h2-9,14,21-23,35H,10-13,15-17H2,(H,32,37)(H,33,36)/t21?,22?,23-,26?/m0/s1 |
| InChIKey | PWZUNHJWOBUUQE-OFXVJIJHSA-N |
| XLogP | 3.35 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|