About 3,5-dimethyl-1,2-dihydrotriazole
3,5-dimethyl-1,2-dihydrotriazole (PubChem CID 59556528) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,2-dihydrotriazole |
| PubChem CID | 59556528 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 3,5-dimethyl-1,2-dihydrotriazole |
| SMILES | CC1=CN(C)NN1 |
| InChI | InChI=1S/C4H9N3/c1-4-3-7(2)6-5-4/h3,5-6H,1-2H3 |
| InChIKey | HXKAMSYMKXBBPP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,2-dihydrotriazole?
The IUPAC name of 3,5-dimethyl-1,2-dihydrotriazole (CID 59556528) is 3,5-dimethyl-1,2-dihydrotriazole.
What is the SMILES notation for 3,5-dimethyl-1,2-dihydrotriazole?
The canonical SMILES for 3,5-dimethyl-1,2-dihydrotriazole is CC1=CN(C)NN1.
What is the InChIKey of 3,5-dimethyl-1,2-dihydrotriazole?
The InChIKey is HXKAMSYMKXBBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3/c1-4-3-7(2)6-5-4/h3,5-6H,1-2H3.
What are the key properties of 3,5-dimethyl-1,2-dihydrotriazole?
3,5-dimethyl-1,2-dihydrotriazole has a molecular weight of 99.14 g/mol, XLogP of -0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,2-dihydrotriazole is sourced from PubChem (CID 59556528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).